C14H21ClN2O4 — CID 43088875
2-(5-chloro-2,4-dimethoxyanilino)-N-(2-methoxyethyl)propanamide (PubChem CID 43088875) has the molecular formula C14H21ClN2O4 and a molecular weight of 316.79 g/mol. Its IUPAC name is 2-(5-chloro-2,4-dimethoxyanilino)-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-(5-chloro-2,4-dimethoxyanilino)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 43088875 |
| Molecular Formula | C14H21ClN2O4 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-(5-chloro-2,4-dimethoxyanilino)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)Nc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C14H21ClN2O4/c1-9(14(18)16-5-6-19-2)17-11-7-10(15)12(20-3)8-13(11)21-4/h7-9,17H,5-6H2,1-4H3,(H,16,18) |
| InChIKey | LBQWTKGKEUJFPU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|