C12H18Cl2N4O2 — CID 102759668
2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-(2-methoxyethyl)propanamide (PubChem CID 102759668) has the molecular formula C12H18Cl2N4O2 and a molecular weight of 321.21 g/mol. Its IUPAC name is 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 102759668 |
| Molecular Formula | C12H18Cl2N4O2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-(2-methoxyethyl)propanamide |
| SMILES | CNc1nc(NC(C)C(=O)NCCOC)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N4O2/c1-7(12(19)16-4-5-20-3)17-11-9(14)6-8(13)10(15-2)18-11/h6-7H,4-5H2,1-3H3,(H,16,19)(H2,15,17,18) |
| InChIKey | RUQBABVZEXIUSH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|