C11H15F2N3O2 — CID 113407924
2-[(3,5-difluoro-2-pyridinyl)amino]-N-(2-methoxyethyl)propanamide (PubChem CID 113407924) has the molecular formula C11H15F2N3O2 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-[(3,5-difluoro-2-pyridinyl)amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[(3,5-difluoro-2-pyridinyl)amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 113407924 |
| Molecular Formula | C11H15F2N3O2 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-[(3,5-difluoro-2-pyridinyl)amino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)Nc1ncc(F)cc1F |
| InChI | InChI=1S/C11H15F2N3O2/c1-7(11(17)14-3-4-18-2)16-10-9(13)5-8(12)6-15-10/h5-7H,3-4H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | LUMQAXJKRDFTCQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|