C10H16ClN5O2 — CID 114049887
2-[(6-amino-5-chloropyrimidin-4-yl)amino]-N-(2-methoxyethyl)propanamide (PubChem CID 114049887) has the molecular formula C10H16ClN5O2 and a molecular weight of 273.72 g/mol. Its IUPAC name is 2-[(6-amino-5-chloropyrimidin-4-yl)amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[(6-amino-5-chloropyrimidin-4-yl)amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 114049887 |
| Molecular Formula | C10H16ClN5O2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-[(6-amino-5-chloropyrimidin-4-yl)amino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)Nc1ncnc(N)c1Cl |
| InChI | InChI=1S/C10H16ClN5O2/c1-6(10(17)13-3-4-18-2)16-9-7(11)8(12)14-5-15-9/h5-6H,3-4H2,1-2H3,(H,13,17)(H3,12,14,15,16) |
| InChIKey | PPKIATISXNZEPH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|