C9H15ClN4O — CID 106811981
5-chloro-4-N-(4-methoxybutan-2-yl)pyrimidine-4,6-diamine (PubChem CID 106811981) has the molecular formula C9H15ClN4O and a molecular weight of 230.70 g/mol. Its IUPAC name is 5-chloro-4-N-(4-methoxybutan-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 5-chloro-4-N-(4-methoxybutan-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106811981 |
| Molecular Formula | C9H15ClN4O |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 5-chloro-4-N-(4-methoxybutan-2-yl)pyrimidine-4,6-diamine |
| SMILES | COCCC(C)Nc1ncnc(N)c1Cl |
| InChI | InChI=1S/C9H15ClN4O/c1-6(3-4-15-2)14-9-7(10)8(11)12-5-13-9/h5-6H,3-4H2,1-2H3,(H3,11,12,13,14) |
| InChIKey | OCSMEJZEGDNXAM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |