C10H17ClN4S — CID 106812170
5-chloro-4-N-(4-ethylsulfanylbutan-2-yl)pyrimidine-4,6-diamine (PubChem CID 106812170) has the molecular formula C10H17ClN4S and a molecular weight of 260.79 g/mol. Its IUPAC name is 5-chloro-4-N-(4-ethylsulfanylbutan-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 5-chloro-4-N-(4-ethylsulfanylbutan-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106812170 |
| Molecular Formula | C10H17ClN4S |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 5-chloro-4-N-(4-ethylsulfanylbutan-2-yl)pyrimidine-4,6-diamine |
| SMILES | CCSCCC(C)Nc1ncnc(N)c1Cl |
| InChI | InChI=1S/C10H17ClN4S/c1-3-16-5-4-7(2)15-10-8(11)9(12)13-6-14-10/h6-7H,3-5H2,1-2H3,(H3,12,13,14,15) |
| InChIKey | IBAAEGPVHGDTHD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|