C12H17ClN6O2 — CID 103076893
2-[(5-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]-N-(2-methoxyethyl)propanamide (PubChem CID 103076893) has the molecular formula C12H17ClN6O2 and a molecular weight of 312.76 g/mol. Its IUPAC name is 2-[(5-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[(5-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 103076893 |
| Molecular Formula | C12H17ClN6O2 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-[(5-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)Nc1c(C)c(Cl)nc2ncnn12 |
| InChI | InChI=1S/C12H17ClN6O2/c1-7-9(13)18-12-15-6-16-19(12)10(7)17-8(2)11(20)14-4-5-21-3/h6,8,17H,4-5H2,1-3H3,(H,14,20) |
| InChIKey | QKDZNZPCFXTFOZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|