C10H17ClN4O3 — CID 106958390
2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]-N-(2-methoxyethyl)propanamide (PubChem CID 106958390) has the molecular formula C10H17ClN4O3 and a molecular weight of 276.72 g/mol. Its IUPAC name is 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 106958390 |
| Molecular Formula | C10H17ClN4O3 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)Nc1nnc(C(C)Cl)o1 |
| InChI | InChI=1S/C10H17ClN4O3/c1-6(11)9-14-15-10(18-9)13-7(2)8(16)12-4-5-17-3/h6-7H,4-5H2,1-3H3,(H,12,16)(H,13,15) |
| InChIKey | KNFPGHYMWRCZCJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|