C11H18N2O3 — CID 104788694
N-(2-methoxyethyl)-2-[(3-oxocyclopenten-1-yl)amino]propanamide (PubChem CID 104788694) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[(3-oxocyclopenten-1-yl)amino]propanamide.
| Compound Name | N-(2-methoxyethyl)-2-[(3-oxocyclopenten-1-yl)amino]propanamide |
|---|---|
| PubChem CID | 104788694 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-(2-methoxyethyl)-2-[(3-oxocyclopenten-1-yl)amino]propanamide |
| SMILES | COCCNC(=O)C(C)NC1=CC(=O)CC1 |
| InChI | InChI=1S/C11H18N2O3/c1-8(11(15)12-5-6-16-2)13-9-3-4-10(14)7-9/h7-8,13H,3-6H2,1-2H3,(H,12,15) |
| InChIKey | MOVYLXXGWNQMHW-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|