C8H19N3O2 — CID 83013633
2-(2,2-dimethylhydrazinyl)-N-(2-methoxyethyl)propanamide (PubChem CID 83013633) has the molecular formula C8H19N3O2 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(2,2-dimethylhydrazinyl)-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-(2,2-dimethylhydrazinyl)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 83013633 |
| Molecular Formula | C8H19N3O2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-(2,2-dimethylhydrazinyl)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)NN(C)C |
| InChI | InChI=1S/C8H19N3O2/c1-7(10-11(2)3)8(12)9-5-6-13-4/h7,10H,5-6H2,1-4H3,(H,9,12) |
| InChIKey | DELLCYWRRNQMJJ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|