C10H20N4O4 — CID 113407032
2-[[1-(carbamoylamino)-1-oxopropan-2-yl]amino]-N-(2-methoxyethyl)propanamide (PubChem CID 113407032) has the molecular formula C10H20N4O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-[[1-(carbamoylamino)-1-oxopropan-2-yl]amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[[1-(carbamoylamino)-1-oxopropan-2-yl]amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 113407032 |
| Molecular Formula | C10H20N4O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-[[1-(carbamoylamino)-1-oxopropan-2-yl]amino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)NC(C)C(=O)NC(N)=O |
| InChI | InChI=1S/C10H20N4O4/c1-6(8(15)12-4-5-18-3)13-7(2)9(16)14-10(11)17/h6-7,13H,4-5H2,1-3H3,(H,12,15)(H3,11,14,16,17) |
| InChIKey | QVHXZHPJPNVJDZ-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|