C10H20N2O2 — CID 107899218
2-[[(E)-but-2-enyl]amino]-N-(2-methoxyethyl)propanamide (PubChem CID 107899218) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-[[(E)-but-2-enyl]amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[[(E)-but-2-enyl]amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 107899218 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2-[[(E)-but-2-enyl]amino]-N-(2-methoxyethyl)propanamide |
| SMILES | C/C=C/CNC(C)C(=O)NCCOC |
| InChI | InChI=1S/C10H20N2O2/c1-4-5-6-11-9(2)10(13)12-7-8-14-3/h4-5,9,11H,6-8H2,1-3H3,(H,12,13)/b5-4+ |
| InChIKey | LDNLBSIRDNCVIF-SNAWJCMRSA-N |
| XLogP | 0.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|