C11H24N2O4 — CID 114243601
2-[2-(2-hydroxyethoxy)ethyl-methylamino]-N-(2-methoxyethyl)propanamide (PubChem CID 114243601) has the molecular formula C11H24N2O4 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethyl-methylamino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethyl-methylamino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 114243601 |
| Molecular Formula | C11H24N2O4 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethyl-methylamino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)N(C)CCOCCO |
| InChI | InChI=1S/C11H24N2O4/c1-10(11(15)12-4-7-16-3)13(2)5-8-17-9-6-14/h10,14H,4-9H2,1-3H3,(H,12,15) |
| InChIKey | JTADPAAPPNRCPD-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|