About 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide
2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide (PubChem CID 102756840) has the molecular formula C10H14Cl2N4O
and a molecular weight of 277.16 g/mol. Its IUPAC name is 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide.
Molecular Properties
| Compound Name | 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide |
| PubChem CID | 102756840 |
| Molecular Formula | C10H14Cl2N4O |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)Nc1nc(NC)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H14Cl2N4O/c1-5(10(17)14-3)15-9-7(12)4-6(11)8(13-2)16-9/h4-5H,1-3H3,(H,14,17)(H2,13,15,16) |
| InChIKey | NCAONISXKGIVII-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide?
The IUPAC name of 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide (CID 102756840) is 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide.
What is the SMILES notation for 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide?
The canonical SMILES for 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide is CNC(=O)C(C)Nc1nc(NC)c(Cl)cc1Cl.
What is the InChIKey of 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide?
The InChIKey is NCAONISXKGIVII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Cl2N4O/c1-5(10(17)14-3)15-9-7(12)4-6(11)8(13-2)16-9/h4-5H,1-3H3,(H,14,17)(H2,13,15,16).
What are the key properties of 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide?
2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide has a molecular weight of 277.16 g/mol, XLogP of 1.98, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-dichloro-6-(methylamino)-2-pyridinyl]amino]-N-methylpropanamide is sourced from PubChem (CID 102756840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).