C12H19N7O2 — CID 114786133
N-(2-methoxyethyl)-2-[[2-(methylamino)-7H-purin-6-yl]amino]propanamide (PubChem CID 114786133) has the molecular formula C12H19N7O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[2-(methylamino)-7H-purin-6-yl]amino]propanamide.
| Compound Name | N-(2-methoxyethyl)-2-[[2-(methylamino)-7H-purin-6-yl]amino]propanamide |
|---|---|
| PubChem CID | 114786133 |
| Molecular Formula | C12H19N7O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[2-(methylamino)-7H-purin-6-yl]amino]propanamide |
| SMILES | CNc1nc(NC(C)C(=O)NCCOC)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H19N7O2/c1-7(11(20)14-4-5-21-3)17-10-8-9(16-6-15-8)18-12(13-2)19-10/h6-7H,4-5H2,1-3H3,(H,14,20)(H3,13,15,16,17,18,19) |
| InChIKey | BIWRJGVSRIQTIO-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 116.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|