C19H21ClN2O4 — CID 35960485
(2S)-N-(2-acetylphenyl)-2-(5-chloro-2,4-dimethoxyanilino)propanamide (PubChem CID 35960485) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is (2S)-N-(2-acetylphenyl)-2-(5-chloro-2,4-dimethoxyanilino)propanamide.
| Compound Name | (2S)-N-(2-acetylphenyl)-2-(5-chloro-2,4-dimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 35960485 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (2S)-N-(2-acetylphenyl)-2-(5-chloro-2,4-dimethoxyanilino)propanamide |
| SMILES | COc1cc(OC)c(N[C@@H](C)C(=O)Nc2ccccc2C(C)=O)cc1Cl |
| InChI | InChI=1S/C19H21ClN2O4/c1-11(19(24)22-15-8-6-5-7-13(15)12(2)23)21-16-9-14(20)17(25-3)10-18(16)26-4/h5-11,21H,1-4H3,(H,22,24)/t11-/m0/s1 |
| InChIKey | RDLOLLQHIMNWJI-NSHDSACASA-N |
| XLogP | 4.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|