C10H17N3 — CID 83828103
2-N-(2,5-dimethyl-4-pyridinyl)propane-1,2-diamine (PubChem CID 83828103) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-N-(2,5-dimethyl-4-pyridinyl)propane-1,2-diamine.
| Compound Name | 2-N-(2,5-dimethyl-4-pyridinyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 83828103 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2-N-(2,5-dimethyl-4-pyridinyl)propane-1,2-diamine |
| SMILES | Cc1cc(NC(C)CN)c(C)cn1 |
| InChI | InChI=1S/C10H17N3/c1-7-6-12-8(2)4-10(7)13-9(3)5-11/h4,6,9H,5,11H2,1-3H3,(H,12,13) |
| InChIKey | YXSGBSBMOGTQIO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |