About 2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine
2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine (PubChem CID 83828100) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine |
| PubChem CID | 83828100 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine |
| SMILES | Cc1cncc(C)c1NC(C)CN |
| InChI | InChI=1S/C10H17N3/c1-7-5-12-6-8(2)10(7)13-9(3)4-11/h5-6,9H,4,11H2,1-3H3,(H,12,13) |
| InChIKey | LFSUAVVBUIDOAV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine?
The IUPAC name of 2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine (CID 83828100) is 2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine.
What is the SMILES notation for 2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine?
The canonical SMILES for 2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine is Cc1cncc(C)c1NC(C)CN.
What is the InChIKey of 2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine?
The InChIKey is LFSUAVVBUIDOAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-7-5-12-6-8(2)10(7)13-9(3)4-11/h5-6,9H,4,11H2,1-3H3,(H,12,13).
What are the key properties of 2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine?
2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine has a molecular weight of 179.27 g/mol, XLogP of 1.46, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(3,5-dimethyl-4-pyridinyl)propane-1,2-diamine is sourced from PubChem (CID 83828100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).