About 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol
4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol (PubChem CID 106954059) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol |
| PubChem CID | 106954059 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol |
| SMILES | Cc1cc(NC(C)CN)c(C)cc1O |
| InChI | InChI=1S/C11H18N2O/c1-7-5-11(14)8(2)4-10(7)13-9(3)6-12/h4-5,9,13-14H,6,12H2,1-3H3 |
| InChIKey | RVYFKOCQNBVBOA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol?
The IUPAC name of 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol (CID 106954059) is 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol.
What is the SMILES notation for 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol?
The canonical SMILES for 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol is Cc1cc(NC(C)CN)c(C)cc1O.
What is the InChIKey of 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol?
The InChIKey is RVYFKOCQNBVBOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-7-5-11(14)8(2)4-10(7)13-9(3)6-12/h4-5,9,13-14H,6,12H2,1-3H3.
What are the key properties of 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol?
4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol has a molecular weight of 194.28 g/mol, XLogP of 1.77, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol is sourced from PubChem (CID 106954059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).