C11H18N2O — CID 106954059
4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol (PubChem CID 106954059) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol.
| Compound Name | 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol |
|---|---|
| PubChem CID | 106954059 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-(1-aminopropan-2-ylamino)-2,5-dimethylphenol |
| SMILES | Cc1cc(NC(C)CN)c(C)cc1O |
| InChI | InChI=1S/C11H18N2O/c1-7-5-11(14)8(2)4-10(7)13-9(3)6-12/h4-5,9,13-14H,6,12H2,1-3H3 |
| InChIKey | RVYFKOCQNBVBOA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|