C15H24N2O2 — CID 106954435
2-(aminomethyl)-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylpentanamide (PubChem CID 106954435) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylpentanamide.
| Compound Name | 2-(aminomethyl)-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 106954435 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-(aminomethyl)-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylpentanamide |
| SMILES | Cc1cc(NC(=O)C(CN)CC(C)C)c(C)cc1O |
| InChI | InChI=1S/C15H24N2O2/c1-9(2)5-12(8-16)15(19)17-13-6-11(4)14(18)7-10(13)3/h6-7,9,12,18H,5,8,16H2,1-4H3,(H,17,19) |
| InChIKey | VAJRWDHATUIEDF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|