C12H18N2O2 — CID 106954356
4-amino-N-(4-hydroxy-2,5-dimethylphenyl)butanamide (PubChem CID 106954356) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-amino-N-(4-hydroxy-2,5-dimethylphenyl)butanamide.
| Compound Name | 4-amino-N-(4-hydroxy-2,5-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 106954356 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-amino-N-(4-hydroxy-2,5-dimethylphenyl)butanamide |
| SMILES | Cc1cc(NC(=O)CCCN)c(C)cc1O |
| InChI | InChI=1S/C12H18N2O2/c1-8-7-11(15)9(2)6-10(8)14-12(16)4-3-5-13/h6-7,15H,3-5,13H2,1-2H3,(H,14,16) |
| InChIKey | BFAACOHYJTZIGC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|