C16H15F2NO2 — CID 106834565
2-(2,6-difluorophenyl)-N-(4-hydroxy-2,5-dimethylphenyl)acetamide (PubChem CID 106834565) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-N-(4-hydroxy-2,5-dimethylphenyl)acetamide.
| Compound Name | 2-(2,6-difluorophenyl)-N-(4-hydroxy-2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 106834565 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-(2,6-difluorophenyl)-N-(4-hydroxy-2,5-dimethylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)Cc2c(F)cccc2F)c(C)cc1O |
| InChI | InChI=1S/C16H15F2NO2/c1-9-7-15(20)10(2)6-14(9)19-16(21)8-11-12(17)4-3-5-13(11)18/h3-7,20H,8H2,1-2H3,(H,19,21) |
| InChIKey | LNJZONGJMVYTLY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|