C15H15ClFNO — CID 106953996
4-[(2-chloro-6-fluorophenyl)methylamino]-2,5-dimethylphenol (PubChem CID 106953996) has the molecular formula C15H15ClFNO and a molecular weight of 279.74 g/mol. Its IUPAC name is 4-[(2-chloro-6-fluorophenyl)methylamino]-2,5-dimethylphenol.
| Compound Name | 4-[(2-chloro-6-fluorophenyl)methylamino]-2,5-dimethylphenol |
|---|---|
| PubChem CID | 106953996 |
| Molecular Formula | C15H15ClFNO |
| Molecular Weight | 279.74 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methylamino]-2,5-dimethylphenol |
| SMILES | Cc1cc(NCc2c(F)cccc2Cl)c(C)cc1O |
| InChI | InChI=1S/C15H15ClFNO/c1-9-7-15(19)10(2)6-14(9)18-8-11-12(16)4-3-5-13(11)17/h3-7,18-19H,8H2,1-2H3 |
| InChIKey | IUZMQZAPLRFSTC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.74 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|