C16H16ClFN2O — CID 43432293
3-[(2-chloro-6-fluorophenyl)methylamino]-N,4-dimethylbenzamide (PubChem CID 43432293) has the molecular formula C16H16ClFN2O and a molecular weight of 306.77 g/mol. Its IUPAC name is 3-[(2-chloro-6-fluorophenyl)methylamino]-N,4-dimethylbenzamide.
| Compound Name | 3-[(2-chloro-6-fluorophenyl)methylamino]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 43432293 |
| Molecular Formula | C16H16ClFN2O |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3-[(2-chloro-6-fluorophenyl)methylamino]-N,4-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(C)c(NCc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C16H16ClFN2O/c1-10-6-7-11(16(21)19-2)8-15(10)20-9-12-13(17)4-3-5-14(12)18/h3-8,20H,9H2,1-2H3,(H,19,21) |
| InChIKey | FSJOBQONXVZHAX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |