C13H22N2O2 — CID 115196355
1-N-(2,5-dimethoxy-3,4-dimethylphenyl)propane-1,2-diamine (PubChem CID 115196355) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-N-(2,5-dimethoxy-3,4-dimethylphenyl)propane-1,2-diamine.
| Compound Name | 1-N-(2,5-dimethoxy-3,4-dimethylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 115196355 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-N-(2,5-dimethoxy-3,4-dimethylphenyl)propane-1,2-diamine |
| SMILES | COc1cc(NCC(C)N)c(OC)c(C)c1C |
| InChI | InChI=1S/C13H22N2O2/c1-8(14)7-15-11-6-12(16-4)9(2)10(3)13(11)17-5/h6,8,15H,7,14H2,1-5H3 |
| InChIKey | YZLFYKHGQMKNPI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |