C12H19NO3 — CID 115258305
2,5-dimethoxy-N-(methoxymethyl)-3,4-dimethylaniline (PubChem CID 115258305) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2,5-dimethoxy-N-(methoxymethyl)-3,4-dimethylaniline.
| Compound Name | 2,5-dimethoxy-N-(methoxymethyl)-3,4-dimethylaniline |
|---|---|
| PubChem CID | 115258305 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 2,5-dimethoxy-N-(methoxymethyl)-3,4-dimethylaniline |
| SMILES | COCNc1cc(OC)c(C)c(C)c1OC |
| InChI | InChI=1S/C12H19NO3/c1-8-9(2)12(16-5)10(13-7-14-3)6-11(8)15-4/h6,13H,7H2,1-5H3 |
| InChIKey | FDYZXNOEMALDGL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|