C12H19NO2 — CID 115258230
4-methoxy-N-(methoxymethyl)-2,3,5-trimethylaniline (PubChem CID 115258230) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-methoxy-N-(methoxymethyl)-2,3,5-trimethylaniline.
| Compound Name | 4-methoxy-N-(methoxymethyl)-2,3,5-trimethylaniline |
|---|---|
| PubChem CID | 115258230 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 4-methoxy-N-(methoxymethyl)-2,3,5-trimethylaniline |
| SMILES | COCNc1cc(C)c(OC)c(C)c1C |
| InChI | InChI=1S/C12H19NO2/c1-8-6-11(13-7-14-4)9(2)10(3)12(8)15-5/h6,13H,7H2,1-5H3 |
| InChIKey | RBMDIJDUSPEQIY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|