C13H20N2O3 — CID 115240470
2-amino-3-(4-methoxy-2,3,5-trimethylanilino)propanoic acid (PubChem CID 115240470) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-amino-3-(4-methoxy-2,3,5-trimethylanilino)propanoic acid.
| Compound Name | 2-amino-3-(4-methoxy-2,3,5-trimethylanilino)propanoic acid |
|---|---|
| PubChem CID | 115240470 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-amino-3-(4-methoxy-2,3,5-trimethylanilino)propanoic acid |
| SMILES | COc1c(C)cc(NCC(N)C(=O)O)c(C)c1C |
| InChI | InChI=1S/C13H20N2O3/c1-7-5-11(15-6-10(14)13(16)17)8(2)9(3)12(7)18-4/h5,10,15H,6,14H2,1-4H3,(H,16,17) |
| InChIKey | FGWCOHCDPJAWEB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|