C11H17NO — CID 115258290
N-(methoxymethyl)-2,3,4-trimethylaniline (PubChem CID 115258290) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N-(methoxymethyl)-2,3,4-trimethylaniline.
| Compound Name | N-(methoxymethyl)-2,3,4-trimethylaniline |
|---|---|
| PubChem CID | 115258290 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-(methoxymethyl)-2,3,4-trimethylaniline |
| SMILES | COCNc1ccc(C)c(C)c1C |
| InChI | InChI=1S/C11H17NO/c1-8-5-6-11(12-7-13-4)10(3)9(8)2/h5-6,12H,7H2,1-4H3 |
| InChIKey | VJZRTFHWJGWYEA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|