C12H20N2 — CID 115196344
1-N-(2,3,4-trimethylphenyl)propane-1,2-diamine (PubChem CID 115196344) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-N-(2,3,4-trimethylphenyl)propane-1,2-diamine.
| Compound Name | 1-N-(2,3,4-trimethylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 115196344 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-N-(2,3,4-trimethylphenyl)propane-1,2-diamine |
| SMILES | Cc1ccc(NCC(C)N)c(C)c1C |
| InChI | InChI=1S/C12H20N2/c1-8-5-6-12(11(4)10(8)3)14-7-9(2)13/h5-6,9,14H,7,13H2,1-4H3 |
| InChIKey | IFBRCBWWZQJNQU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |