C15H23NO3 — CID 115123520
methyl 4-hydroxy-5-(2,3,4-trimethylanilino)pentanoate (PubChem CID 115123520) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is methyl 4-hydroxy-5-(2,3,4-trimethylanilino)pentanoate.
| Compound Name | methyl 4-hydroxy-5-(2,3,4-trimethylanilino)pentanoate |
|---|---|
| PubChem CID | 115123520 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | methyl 4-hydroxy-5-(2,3,4-trimethylanilino)pentanoate |
| SMILES | COC(=O)CCC(O)CNc1ccc(C)c(C)c1C |
| InChI | InChI=1S/C15H23NO3/c1-10-5-7-14(12(3)11(10)2)16-9-13(17)6-8-15(18)19-4/h5,7,13,16-17H,6,8-9H2,1-4H3 |
| InChIKey | ZMVQJNRQZXLIAP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |