C15H20ClF3N2O3 — CID 168639762
methyl 4-[2-[(3-chloro-2-hydroxypropyl)amino]-4-(trifluoromethyl)anilino]butanoate (PubChem CID 168639762) has the molecular formula C15H20ClF3N2O3 and a molecular weight of 368.78 g/mol. Its IUPAC name is methyl 4-[2-[(3-chloro-2-hydroxypropyl)amino]-4-(trifluoromethyl)anilino]butanoate.
| Compound Name | methyl 4-[2-[(3-chloro-2-hydroxypropyl)amino]-4-(trifluoromethyl)anilino]butanoate |
|---|---|
| PubChem CID | 168639762 |
| Molecular Formula | C15H20ClF3N2O3 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | methyl 4-[2-[(3-chloro-2-hydroxypropyl)amino]-4-(trifluoromethyl)anilino]butanoate |
| SMILES | COC(=O)CCCNc1ccc(C(F)(F)F)cc1NCC(O)CCl |
| InChI | InChI=1S/C15H20ClF3N2O3/c1-24-14(23)3-2-6-20-12-5-4-10(15(17,18)19)7-13(12)21-9-11(22)8-16/h4-5,7,11,20-22H,2-3,6,8-9H2,1H3 |
| InChIKey | QZKYWIRQWCWJMV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|