C14H20ClF3N2O — CID 168638288
1-chloro-3-[2-(diethylamino)-5-(trifluoromethyl)anilino]propan-2-ol (PubChem CID 168638288) has the molecular formula C14H20ClF3N2O and a molecular weight of 324.77 g/mol. Its IUPAC name is 1-chloro-3-[2-(diethylamino)-5-(trifluoromethyl)anilino]propan-2-ol.
| Compound Name | 1-chloro-3-[2-(diethylamino)-5-(trifluoromethyl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 168638288 |
| Molecular Formula | C14H20ClF3N2O |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-chloro-3-[2-(diethylamino)-5-(trifluoromethyl)anilino]propan-2-ol |
| SMILES | CCN(CC)c1ccc(C(F)(F)F)cc1NCC(O)CCl |
| InChI | InChI=1S/C14H20ClF3N2O/c1-3-20(4-2)13-6-5-10(14(16,17)18)7-12(13)19-9-11(21)8-15/h5-7,11,19,21H,3-4,8-9H2,1-2H3 |
| InChIKey | NRSGAIQWJSGORL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|