C14H16F3NO4 — CID 168594620
methyl 3-[2-(2,3-dihydroxypropylamino)-4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 168594620) has the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. Its IUPAC name is methyl 3-[2-(2,3-dihydroxypropylamino)-4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | methyl 3-[2-(2,3-dihydroxypropylamino)-4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 168594620 |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | methyl 3-[2-(2,3-dihydroxypropylamino)-4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(C(F)(F)F)cc1NCC(O)CO |
| InChI | InChI=1S/C14H16F3NO4/c1-22-13(21)5-3-9-2-4-10(14(15,16)17)6-12(9)18-7-11(20)8-19/h2-6,11,18-20H,7-8H2,1H3 |
| InChIKey | CYMKRJGOWOKGEZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|