C14H19F4NO2 — CID 63036846
1-[2-fluoro-5-(trifluoromethyl)anilino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol (PubChem CID 63036846) has the molecular formula C14H19F4NO2 and a molecular weight of 309.30 g/mol. Its IUPAC name is 1-[2-fluoro-5-(trifluoromethyl)anilino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol.
| Compound Name | 1-[2-fluoro-5-(trifluoromethyl)anilino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 63036846 |
| Molecular Formula | C14H19F4NO2 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-[2-fluoro-5-(trifluoromethyl)anilino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol |
| SMILES | CC(C)(C)OCC(O)CNc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C14H19F4NO2/c1-13(2,3)21-8-10(20)7-19-12-6-9(14(16,17)18)4-5-11(12)15/h4-6,10,19-20H,7-8H2,1-3H3 |
| InChIKey | WUQRETQPTRKCOK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |