C15H21ClF3N3O — CID 168638004
1-chloro-3-[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)anilino]propan-2-ol (PubChem CID 168638004) has the molecular formula C15H21ClF3N3O and a molecular weight of 351.80 g/mol. Its IUPAC name is 1-chloro-3-[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)anilino]propan-2-ol.
| Compound Name | 1-chloro-3-[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 168638004 |
| Molecular Formula | C15H21ClF3N3O |
| Molecular Weight | 351.80 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-chloro-3-[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)anilino]propan-2-ol |
| SMILES | CN1CCN(c2ccc(C(F)(F)F)cc2NCC(O)CCl)CC1 |
| InChI | InChI=1S/C15H21ClF3N3O/c1-21-4-6-22(7-5-21)14-3-2-11(15(17,18)19)8-13(14)20-10-12(23)9-16/h2-3,8,12,20,23H,4-7,9-10H2,1H3 |
| InChIKey | ACEKSQINRXPUHJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.80 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|