C13H17F3N4S — CID 169357396
[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]thiourea (PubChem CID 169357396) has the molecular formula C13H17F3N4S and a molecular weight of 318.37 g/mol. Its IUPAC name is [2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]thiourea.
| Compound Name | [2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 169357396 |
| Molecular Formula | C13H17F3N4S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]thiourea |
| SMILES | CN1CCN(c2ccc(C(F)(F)F)cc2NC(N)=S)CC1 |
| InChI | InChI=1S/C13H17F3N4S/c1-19-4-6-20(7-5-19)11-3-2-9(13(14,15)16)8-10(11)18-12(17)21/h2-3,8H,4-7H2,1H3,(H3,17,18,21) |
| InChIKey | YYZZLNRNOALBHY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|