C19H19F4N3O — CID 1194264
3-fluoro-N-[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 1194264) has the molecular formula C19H19F4N3O and a molecular weight of 381.37 g/mol. Its IUPAC name is 3-fluoro-N-[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-fluoro-N-[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1194264 |
| Molecular Formula | C19H19F4N3O |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-fluoro-N-[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | CN1CCN(c2ccc(C(F)(F)F)cc2NC(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H19F4N3O/c1-25-7-9-26(10-8-25)17-6-5-14(19(21,22)23)12-16(17)24-18(27)13-3-2-4-15(20)11-13/h2-6,11-12H,7-10H2,1H3,(H,24,27) |
| InChIKey | BOCCGVCABZZCHS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |