C13H15F3N2O3 — CID 168652302
methyl 4-[2-formamido-4-(trifluoromethyl)anilino]butanoate (PubChem CID 168652302) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is methyl 4-[2-formamido-4-(trifluoromethyl)anilino]butanoate.
| Compound Name | methyl 4-[2-formamido-4-(trifluoromethyl)anilino]butanoate |
|---|---|
| PubChem CID | 168652302 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | methyl 4-[2-formamido-4-(trifluoromethyl)anilino]butanoate |
| SMILES | COC(=O)CCCNc1ccc(C(F)(F)F)cc1NC=O |
| InChI | InChI=1S/C13H15F3N2O3/c1-21-12(20)3-2-6-17-10-5-4-9(13(14,15)16)7-11(10)18-8-19/h4-5,7-8,17H,2-3,6H2,1H3,(H,18,19) |
| InChIKey | FXPXWGMWWGZMJY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|