C15H22F3N3O — CID 119290972
4-amino-N-[2-(butylamino)-5-(trifluoromethyl)phenyl]butanamide (PubChem CID 119290972) has the molecular formula C15H22F3N3O and a molecular weight of 317.36 g/mol. Its IUPAC name is 4-amino-N-[2-(butylamino)-5-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-amino-N-[2-(butylamino)-5-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 119290972 |
| Molecular Formula | C15H22F3N3O |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 4-amino-N-[2-(butylamino)-5-(trifluoromethyl)phenyl]butanamide |
| SMILES | CCCCNc1ccc(C(F)(F)F)cc1NC(=O)CCCN |
| InChI | InChI=1S/C15H22F3N3O/c1-2-3-9-20-12-7-6-11(15(16,17)18)10-13(12)21-14(22)5-4-8-19/h6-7,10,20H,2-5,8-9,19H2,1H3,(H,21,22) |
| InChIKey | KZPJWQRVQREQHL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|