C13H18F3N3O3S — CID 119775808
N-[2-(methanesulfonamido)-5-(trifluoromethyl)phenyl]-4-(methylamino)butanamide (PubChem CID 119775808) has the molecular formula C13H18F3N3O3S and a molecular weight of 353.37 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)-5-(trifluoromethyl)phenyl]-4-(methylamino)butanamide.
| Compound Name | N-[2-(methanesulfonamido)-5-(trifluoromethyl)phenyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119775808 |
| Molecular Formula | C13H18F3N3O3S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[2-(methanesulfonamido)-5-(trifluoromethyl)phenyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1cc(C(F)(F)F)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C13H18F3N3O3S/c1-17-7-3-4-12(20)18-11-8-9(13(14,15)16)5-6-10(11)19-23(2,21)22/h5-6,8,17,19H,3-4,7H2,1-2H3,(H,18,20) |
| InChIKey | QIYXYZGYXWDYAN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|