C12H13F3N2O3 — CID 79532254
2-[3-(methylamino)propanoylamino]-4-(trifluoromethyl)benzoic acid (PubChem CID 79532254) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is 2-[3-(methylamino)propanoylamino]-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-[3-(methylamino)propanoylamino]-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 79532254 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[3-(methylamino)propanoylamino]-4-(trifluoromethyl)benzoic acid |
| SMILES | CNCCC(=O)Nc1cc(C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C12H13F3N2O3/c1-16-5-4-10(18)17-9-6-7(12(13,14)15)2-3-8(9)11(19)20/h2-3,6,16H,4-5H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | GQTQYLMMACERAT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |