2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid

C13H14F3NO3 — CID 79532501

IUPAC2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid
SMILESCC(C)(C)C(=O)Nc1cc(C(F)(F)F)ccc1C(=O)O
InChIInChI=1S/C13H14F3NO3/c1-12(2,3)11(20)17-9-6-7(13(14,15)16)4-5-8(9)10(18)19/h4-6H,1-3H3,(H,17,20)(H,18,19)
InChIKeyDJBHRSITAFUYCN-UHFFFAOYSA-N
MW289.25 g/mol
LogP3.39
Rot. Bonds2

About 2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid

2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid (PubChem CID 79532501) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid.

Molecular Properties

Compound Name2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid
PubChem CID79532501
Molecular FormulaC13H14F3NO3
Molecular Weight289.25 g/mol
Exact Mass289.09
IUPAC Name2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid
SMILESCC(C)(C)C(=O)Nc1cc(C(F)(F)F)ccc1C(=O)O
InChIInChI=1S/C13H14F3NO3/c1-12(2,3)11(20)17-9-6-7(13(14,15)16)4-5-8(9)10(18)19/h4-6H,1-3H3,(H,17,20)(H,18,19)
InChIKeyDJBHRSITAFUYCN-UHFFFAOYSA-N
XLogP3.39
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.25
LogP ≤ 53.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid?
The IUPAC name of 2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid (CID 79532501) is 2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid.
What is the SMILES notation for 2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid?
The canonical SMILES for 2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid is CC(C)(C)C(=O)Nc1cc(C(F)(F)F)ccc1C(=O)O.
What is the InChIKey of 2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid?
The InChIKey is DJBHRSITAFUYCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3NO3/c1-12(2,3)11(20)17-9-6-7(13(14,15)16)4-5-8(9)10(18)19/h4-6H,1-3H3,(H,17,20)(H,18,19).
What are the key properties of 2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid?
2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid has a molecular weight of 289.25 g/mol, XLogP of 3.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)benzoic acid is sourced from PubChem (CID 79532501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).