C15H11BrF3NO2 — CID 155452295
2-(4-bromo-2-methylanilino)-4-(trifluoromethyl)benzoic acid (PubChem CID 155452295) has the molecular formula C15H11BrF3NO2 and a molecular weight of 374.16 g/mol. Its IUPAC name is 2-(4-bromo-2-methylanilino)-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(4-bromo-2-methylanilino)-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 155452295 |
| Molecular Formula | C15H11BrF3NO2 |
| Molecular Weight | 374.16 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 2-(4-bromo-2-methylanilino)-4-(trifluoromethyl)benzoic acid |
| SMILES | Cc1cc(Br)ccc1Nc1cc(C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C15H11BrF3NO2/c1-8-6-10(16)3-5-12(8)20-13-7-9(15(17,18)19)2-4-11(13)14(21)22/h2-7,20H,1H3,(H,21,22) |
| InChIKey | ZLRHIEQSATUYOX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.16 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |