C21H15BrF4N2O — CID 155452624
N-(3-bromophenyl)-2-(4-fluoro-2-methylanilino)-4-(trifluoromethyl)benzamide (PubChem CID 155452624) has the molecular formula C21H15BrF4N2O and a molecular weight of 467.26 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(4-fluoro-2-methylanilino)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(3-bromophenyl)-2-(4-fluoro-2-methylanilino)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 155452624 |
| Molecular Formula | C21H15BrF4N2O |
| Molecular Weight | 467.26 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | N-(3-bromophenyl)-2-(4-fluoro-2-methylanilino)-4-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(F)ccc1Nc1cc(C(F)(F)F)ccc1C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C21H15BrF4N2O/c1-12-9-15(23)6-8-18(12)28-19-10-13(21(24,25)26)5-7-17(19)20(29)27-16-4-2-3-14(22)11-16/h2-11,28H,1H3,(H,27,29) |
| InChIKey | CLEVADDYYXTSPD-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.26 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |