C17H15F3NO2P — CID 155747630
2-(2-cyclopropyl-4-phosphanylanilino)-4-(trifluoromethyl)benzoic acid (PubChem CID 155747630) has the molecular formula C17H15F3NO2P and a molecular weight of 353.28 g/mol. Its IUPAC name is 2-(2-cyclopropyl-4-phosphanylanilino)-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(2-cyclopropyl-4-phosphanylanilino)-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 155747630 |
| Molecular Formula | C17H15F3NO2P |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-(2-cyclopropyl-4-phosphanylanilino)-4-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(C(F)(F)F)cc1Nc1ccc(P)cc1C1CC1 |
| InChI | InChI=1S/C17H15F3NO2P/c18-17(19,20)10-3-5-12(16(22)23)15(7-10)21-14-6-4-11(24)8-13(14)9-1-2-9/h3-9,21H,1-2,24H2,(H,22,23) |
| InChIKey | ANKCBOXCVXUNJI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|