C15H10F5NO2 — CID 155452887
2-(3,4-difluoro-2-methylanilino)-5-(trifluoromethyl)benzoic acid (PubChem CID 155452887) has the molecular formula C15H10F5NO2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 2-(3,4-difluoro-2-methylanilino)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(3,4-difluoro-2-methylanilino)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 155452887 |
| Molecular Formula | C15H10F5NO2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-(3,4-difluoro-2-methylanilino)-5-(trifluoromethyl)benzoic acid |
| SMILES | Cc1c(Nc2ccc(C(F)(F)F)cc2C(=O)O)ccc(F)c1F |
| InChI | InChI=1S/C15H10F5NO2/c1-7-11(5-3-10(16)13(7)17)21-12-4-2-8(15(18,19)20)6-9(12)14(22)23/h2-6,21H,1H3,(H,22,23) |
| InChIKey | PGOJSIUADXOWMM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |