C9H9F3N2O4S — CID 114806531
2-(methylsulfamoylamino)-5-(trifluoromethyl)benzoic acid (PubChem CID 114806531) has the molecular formula C9H9F3N2O4S and a molecular weight of 298.24 g/mol. Its IUPAC name is 2-(methylsulfamoylamino)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(methylsulfamoylamino)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 114806531 |
| Molecular Formula | C9H9F3N2O4S |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-(methylsulfamoylamino)-5-(trifluoromethyl)benzoic acid |
| SMILES | CNS(=O)(=O)Nc1ccc(C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C9H9F3N2O4S/c1-13-19(17,18)14-7-3-2-5(9(10,11)12)4-6(7)8(15)16/h2-4,13-14H,1H3,(H,15,16) |
| InChIKey | KNUHUOKUPNUXLQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |