C17H19F3N2O4S — CID 177315572
ethane;5-(methylsulfamoyl)-2-[4-(trifluoromethyl)anilino]benzoic acid (PubChem CID 177315572) has the molecular formula C17H19F3N2O4S and a molecular weight of 404.41 g/mol. Its IUPAC name is ethane;5-(methylsulfamoyl)-2-[4-(trifluoromethyl)anilino]benzoic acid.
| Compound Name | ethane;5-(methylsulfamoyl)-2-[4-(trifluoromethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 177315572 |
| Molecular Formula | C17H19F3N2O4S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | ethane;5-(methylsulfamoyl)-2-[4-(trifluoromethyl)anilino]benzoic acid |
| SMILES | CC.CNS(=O)(=O)c1ccc(Nc2ccc(C(F)(F)F)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H13F3N2O4S.C2H6/c1-19-25(23,24)11-6-7-13(12(8-11)14(21)22)20-10-4-2-9(3-5-10)15(16,17)18;1-2/h2-8,19-20H,1H3,(H,21,22);1-2H3 |
| InChIKey | CQVYHGOMGASQFS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |