C15H12F3NO5S — CID 155342907
5-(methylsulfamoyl)-2-[3-(trifluoromethyl)phenoxy]benzoic acid (PubChem CID 155342907) has the molecular formula C15H12F3NO5S and a molecular weight of 375.32 g/mol. Its IUPAC name is 5-(methylsulfamoyl)-2-[3-(trifluoromethyl)phenoxy]benzoic acid.
| Compound Name | 5-(methylsulfamoyl)-2-[3-(trifluoromethyl)phenoxy]benzoic acid |
|---|---|
| PubChem CID | 155342907 |
| Molecular Formula | C15H12F3NO5S |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 5-(methylsulfamoyl)-2-[3-(trifluoromethyl)phenoxy]benzoic acid |
| SMILES | CNS(=O)(=O)c1ccc(Oc2cccc(C(F)(F)F)c2)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H12F3NO5S/c1-19-25(22,23)11-5-6-13(12(8-11)14(20)21)24-10-4-2-3-9(7-10)15(16,17)18/h2-8,19H,1H3,(H,20,21) |
| InChIKey | WLLBSGLKBSYNSH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |